C22H19F2N3OS — CID 71843841
1-(2,4-difluorophenyl)-3-[(1-ethyl-2-thiophen-2-ylindol-3-yl)methyl]urea (PubChem CID 71843841) has the molecular formula C22H19F2N3OS and a molecular weight of 411.48 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-3-[(1-ethyl-2-thiophen-2-ylindol-3-yl)methyl]urea.
| Compound Name | 1-(2,4-difluorophenyl)-3-[(1-ethyl-2-thiophen-2-ylindol-3-yl)methyl]urea |
|---|---|
| PubChem CID | 71843841 |
| Molecular Formula | C22H19F2N3OS |
| Molecular Weight | 411.48 g/mol |
| Exact Mass | 411.12 |
| IUPAC Name | 1-(2,4-difluorophenyl)-3-[(1-ethyl-2-thiophen-2-ylindol-3-yl)methyl]urea |
| SMILES | CCn1c(-c2cccs2)c(CNC(=O)Nc2ccc(F)cc2F)c2ccccc21 |
| InChI | InChI=1S/C22H19F2N3OS/c1-2-27-19-7-4-3-6-15(19)16(21(27)20-8-5-11-29-20)13-25-22(28)26-18-10-9-14(23)12-17(18)24/h3-12H,2,13H2,1H3,(H2,25,26,28) |
| InChIKey | ORGXCKKJOCSCLG-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 46.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.48 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|