C29H26ClN3OS — CID 53043879
1-benzyl-3-(3-chloro-2-methylphenyl)-1-[(1-methyl-2-thiophen-2-ylindol-3-yl)methyl]urea (PubChem CID 53043879) has the molecular formula C29H26ClN3OS and a molecular weight of 500.07 g/mol. Its IUPAC name is 1-benzyl-3-(3-chloro-2-methylphenyl)-1-[(1-methyl-2-thiophen-2-ylindol-3-yl)methyl]urea.
| Compound Name | 1-benzyl-3-(3-chloro-2-methylphenyl)-1-[(1-methyl-2-thiophen-2-ylindol-3-yl)methyl]urea |
|---|---|
| PubChem CID | 53043879 |
| Molecular Formula | C29H26ClN3OS |
| Molecular Weight | 500.07 g/mol |
| Exact Mass | 499.15 |
| IUPAC Name | 1-benzyl-3-(3-chloro-2-methylphenyl)-1-[(1-methyl-2-thiophen-2-ylindol-3-yl)methyl]urea |
| SMILES | Cc1c(Cl)cccc1NC(=O)N(Cc1ccccc1)Cc1c(-c2cccs2)n(C)c2ccccc12 |
| InChI | InChI=1S/C29H26ClN3OS/c1-20-24(30)13-8-14-25(20)31-29(34)33(18-21-10-4-3-5-11-21)19-23-22-12-6-7-15-26(22)32(2)28(23)27-16-9-17-35-27/h3-17H,18-19H2,1-2H3,(H,31,34) |
| InChIKey | KMSIAMKAEGLBFE-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.07 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|