C24H23N3O3S — CID 45106630
1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-[(1-ethyl-2-thiophen-2-ylindol-3-yl)methyl]urea (PubChem CID 45106630) has the molecular formula C24H23N3O3S and a molecular weight of 433.53 g/mol. Its IUPAC name is 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-[(1-ethyl-2-thiophen-2-ylindol-3-yl)methyl]urea.
| Compound Name | 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-[(1-ethyl-2-thiophen-2-ylindol-3-yl)methyl]urea |
|---|---|
| PubChem CID | 45106630 |
| Molecular Formula | C24H23N3O3S |
| Molecular Weight | 433.53 g/mol |
| Exact Mass | 433.15 |
| IUPAC Name | 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-[(1-ethyl-2-thiophen-2-ylindol-3-yl)methyl]urea |
| SMILES | CCn1c(-c2cccs2)c(CNC(=O)Nc2ccc3c(c2)OCCO3)c2ccccc21 |
| InChI | InChI=1S/C24H23N3O3S/c1-2-27-19-7-4-3-6-17(19)18(23(27)22-8-5-13-31-22)15-25-24(28)26-16-9-10-20-21(14-16)30-12-11-29-20/h3-10,13-14H,2,11-12,15H2,1H3,(H2,25,26,28) |
| InChIKey | RFWFHWSYNKFMRT-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.53 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|