C25H25ClFN3O2S — CID 71843949
3-(3-chloro-4-fluorophenyl)-1-[(1-ethyl-2-thiophen-2-ylindol-3-yl)methyl]-1-(2-methoxyethyl)urea (PubChem CID 71843949) has the molecular formula C25H25ClFN3O2S and a molecular weight of 486.01 g/mol. Its IUPAC name is 3-(3-chloro-4-fluorophenyl)-1-[(1-ethyl-2-thiophen-2-ylindol-3-yl)methyl]-1-(2-methoxyethyl)urea.
| Compound Name | 3-(3-chloro-4-fluorophenyl)-1-[(1-ethyl-2-thiophen-2-ylindol-3-yl)methyl]-1-(2-methoxyethyl)urea |
|---|---|
| PubChem CID | 71843949 |
| Molecular Formula | C25H25ClFN3O2S |
| Molecular Weight | 486.01 g/mol |
| Exact Mass | 485.13 |
| IUPAC Name | 3-(3-chloro-4-fluorophenyl)-1-[(1-ethyl-2-thiophen-2-ylindol-3-yl)methyl]-1-(2-methoxyethyl)urea |
| SMILES | CCn1c(-c2cccs2)c(CN(CCOC)C(=O)Nc2ccc(F)c(Cl)c2)c2ccccc21 |
| InChI | InChI=1S/C25H25ClFN3O2S/c1-3-30-22-8-5-4-7-18(22)19(24(30)23-9-6-14-33-23)16-29(12-13-32-2)25(31)28-17-10-11-21(27)20(26)15-17/h4-11,14-15H,3,12-13,16H2,1-2H3,(H,28,31) |
| InChIKey | UQOBTFRRXKNHQA-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.01 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|