C16H19N3OS — CID 121166342
1-cyclopentyl-3-[(2-thiophen-2-yl-3-pyridinyl)methyl]urea (PubChem CID 121166342) has the molecular formula C16H19N3OS and a molecular weight of 301.41 g/mol. Its IUPAC name is 1-cyclopentyl-3-[(2-thiophen-2-yl-3-pyridinyl)methyl]urea.
| Compound Name | 1-cyclopentyl-3-[(2-thiophen-2-yl-3-pyridinyl)methyl]urea |
|---|---|
| PubChem CID | 121166342 |
| Molecular Formula | C16H19N3OS |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | 1-cyclopentyl-3-[(2-thiophen-2-yl-3-pyridinyl)methyl]urea |
| SMILES | O=C(NCc1cccnc1-c1cccs1)NC1CCCC1 |
| InChI | InChI=1S/C16H19N3OS/c20-16(19-13-6-1-2-7-13)18-11-12-5-3-9-17-15(12)14-8-4-10-21-14/h3-5,8-10,13H,1-2,6-7,11H2,(H2,18,19,20) |
| InChIKey | HJYXQQZIXSFISJ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |