C14H14N4O2S — CID 91625826
2-oxo-N-[(2-thiophen-2-yl-3-pyridinyl)methyl]imidazolidine-1-carboxamide (PubChem CID 91625826) has the molecular formula C14H14N4O2S and a molecular weight of 302.36 g/mol. Its IUPAC name is 2-oxo-N-[(2-thiophen-2-yl-3-pyridinyl)methyl]imidazolidine-1-carboxamide.
| Compound Name | 2-oxo-N-[(2-thiophen-2-yl-3-pyridinyl)methyl]imidazolidine-1-carboxamide |
|---|---|
| PubChem CID | 91625826 |
| Molecular Formula | C14H14N4O2S |
| Molecular Weight | 302.36 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | 2-oxo-N-[(2-thiophen-2-yl-3-pyridinyl)methyl]imidazolidine-1-carboxamide |
| SMILES | O=C1NCCN1C(=O)NCc1cccnc1-c1cccs1 |
| InChI | InChI=1S/C14H14N4O2S/c19-13-16-6-7-18(13)14(20)17-9-10-3-1-5-15-12(10)11-4-2-8-21-11/h1-5,8H,6-7,9H2,(H,16,19)(H,17,20) |
| InChIKey | NYJXPRRCNAMBIS-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.36 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |