C16H20N2O2S2 — CID 121166361
N-[(2-thiophen-2-yl-3-pyridinyl)methyl]cyclohexanesulfonamide (PubChem CID 121166361) has the molecular formula C16H20N2O2S2 and a molecular weight of 336.48 g/mol. Its IUPAC name is N-[(2-thiophen-2-yl-3-pyridinyl)methyl]cyclohexanesulfonamide.
| Compound Name | N-[(2-thiophen-2-yl-3-pyridinyl)methyl]cyclohexanesulfonamide |
|---|---|
| PubChem CID | 121166361 |
| Molecular Formula | C16H20N2O2S2 |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | N-[(2-thiophen-2-yl-3-pyridinyl)methyl]cyclohexanesulfonamide |
| SMILES | O=S(=O)(NCc1cccnc1-c1cccs1)C1CCCCC1 |
| InChI | InChI=1S/C16H20N2O2S2/c19-22(20,14-7-2-1-3-8-14)18-12-13-6-4-10-17-16(13)15-9-5-11-21-15/h4-6,9-11,14,18H,1-3,7-8,12H2 |
| InChIKey | OBCJRBZCHWOXBF-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |