C26H27N3O3S2 — CID 156746212
3-[(cyclobutylamino)methyl]-1-[(4-methylphenyl)methyl]-N-thiophen-2-ylsulfonylindole-2-carboxamide (PubChem CID 156746212) has the molecular formula C26H27N3O3S2 and a molecular weight of 493.65 g/mol. Its IUPAC name is 3-[(cyclobutylamino)methyl]-1-[(4-methylphenyl)methyl]-N-thiophen-2-ylsulfonylindole-2-carboxamide.
| Compound Name | 3-[(cyclobutylamino)methyl]-1-[(4-methylphenyl)methyl]-N-thiophen-2-ylsulfonylindole-2-carboxamide |
|---|---|
| PubChem CID | 156746212 |
| Molecular Formula | C26H27N3O3S2 |
| Molecular Weight | 493.65 g/mol |
| Exact Mass | 493.15 |
| IUPAC Name | 3-[(cyclobutylamino)methyl]-1-[(4-methylphenyl)methyl]-N-thiophen-2-ylsulfonylindole-2-carboxamide |
| SMILES | Cc1ccc(Cn2c(C(=O)NS(=O)(=O)c3cccs3)c(CNC3CCC3)c3ccccc32)cc1 |
| InChI | InChI=1S/C26H27N3O3S2/c1-18-11-13-19(14-12-18)17-29-23-9-3-2-8-21(23)22(16-27-20-6-4-7-20)25(29)26(30)28-34(31,32)24-10-5-15-33-24/h2-3,5,8-15,20,27H,4,6-7,16-17H2,1H3,(H,28,30) |
| InChIKey | PBEJHSYQZJNCNB-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.65 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|