C22H23ClN2O3 — CID 126457150
1-[(3-chlorophenyl)methyl]-3-[(oxolan-2-ylmethylamino)methyl]indole-2-carboxylic acid (PubChem CID 126457150) has the molecular formula C22H23ClN2O3 and a molecular weight of 398.89 g/mol. Its IUPAC name is 1-[(3-chlorophenyl)methyl]-3-[(oxolan-2-ylmethylamino)methyl]indole-2-carboxylic acid.
| Compound Name | 1-[(3-chlorophenyl)methyl]-3-[(oxolan-2-ylmethylamino)methyl]indole-2-carboxylic acid |
|---|---|
| PubChem CID | 126457150 |
| Molecular Formula | C22H23ClN2O3 |
| Molecular Weight | 398.89 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | 1-[(3-chlorophenyl)methyl]-3-[(oxolan-2-ylmethylamino)methyl]indole-2-carboxylic acid |
| SMILES | O=C(O)c1c(CNCC2CCCO2)c2ccccc2n1Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C22H23ClN2O3/c23-16-6-3-5-15(11-16)14-25-20-9-2-1-8-18(20)19(21(25)22(26)27)13-24-12-17-7-4-10-28-17/h1-3,5-6,8-9,11,17,24H,4,7,10,12-14H2,(H,26,27) |
| InChIKey | JUHAAESGLCPARF-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 63.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.89 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|