C21H23ClN2O — CID 124895108
N-[[1-[(3-chlorophenyl)methyl]indol-3-yl]methyl]-1-[(2S)-oxolan-2-yl]methanamine (PubChem CID 124895108) has the molecular formula C21H23ClN2O and a molecular weight of 354.88 g/mol. Its IUPAC name is N-[[1-[(3-chlorophenyl)methyl]indol-3-yl]methyl]-1-[(2S)-oxolan-2-yl]methanamine.
| Compound Name | N-[[1-[(3-chlorophenyl)methyl]indol-3-yl]methyl]-1-[(2S)-oxolan-2-yl]methanamine |
|---|---|
| PubChem CID | 124895108 |
| Molecular Formula | C21H23ClN2O |
| Molecular Weight | 354.88 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | N-[[1-[(3-chlorophenyl)methyl]indol-3-yl]methyl]-1-[(2S)-oxolan-2-yl]methanamine |
| SMILES | Clc1cccc(Cn2cc(CNC[C@@H]3CCCO3)c3ccccc32)c1 |
| InChI | InChI=1S/C21H23ClN2O/c22-18-6-3-5-16(11-18)14-24-15-17(20-8-1-2-9-21(20)24)12-23-13-19-7-4-10-25-19/h1-3,5-6,8-9,11,15,19,23H,4,7,10,12-14H2/t19-/m0/s1 |
| InChIKey | ASQQDXADFVIYCH-IBGZPJMESA-N |
| XLogP | 4.61 |
| TPSA | 26.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.88 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |