C21H26ClN3 — CID 124805206
N-[[1-[(3-chlorophenyl)methyl]indol-3-yl]methyl]-N',N'-dimethylpropane-1,3-diamine (PubChem CID 124805206) has the molecular formula C21H26ClN3 and a molecular weight of 355.91 g/mol. Its IUPAC name is N-[[1-[(3-chlorophenyl)methyl]indol-3-yl]methyl]-N',N'-dimethylpropane-1,3-diamine.
| Compound Name | N-[[1-[(3-chlorophenyl)methyl]indol-3-yl]methyl]-N',N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 124805206 |
| Molecular Formula | C21H26ClN3 |
| Molecular Weight | 355.91 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | N-[[1-[(3-chlorophenyl)methyl]indol-3-yl]methyl]-N',N'-dimethylpropane-1,3-diamine |
| SMILES | CN(C)CCCNCc1cn(Cc2cccc(Cl)c2)c2ccccc12 |
| InChI | InChI=1S/C21H26ClN3/c1-24(2)12-6-11-23-14-18-16-25(21-10-4-3-9-20(18)21)15-17-7-5-8-19(22)13-17/h3-5,7-10,13,16,23H,6,11-12,14-15H2,1-2H3 |
| InChIKey | KIZRDNFSVFPVPL-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 20.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.91 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|