C20H23Cl2N3 — CID 124801601
N-[[1-[(2,6-dichlorophenyl)methyl]indol-3-yl]methyl]-N',N'-dimethylethane-1,2-diamine (PubChem CID 124801601) has the molecular formula C20H23Cl2N3 and a molecular weight of 376.33 g/mol. Its IUPAC name is N-[[1-[(2,6-dichlorophenyl)methyl]indol-3-yl]methyl]-N',N'-dimethylethane-1,2-diamine.
| Compound Name | N-[[1-[(2,6-dichlorophenyl)methyl]indol-3-yl]methyl]-N',N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 124801601 |
| Molecular Formula | C20H23Cl2N3 |
| Molecular Weight | 376.33 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | N-[[1-[(2,6-dichlorophenyl)methyl]indol-3-yl]methyl]-N',N'-dimethylethane-1,2-diamine |
| SMILES | CN(C)CCNCc1cn(Cc2c(Cl)cccc2Cl)c2ccccc12 |
| InChI | InChI=1S/C20H23Cl2N3/c1-24(2)11-10-23-12-15-13-25(20-9-4-3-6-16(15)20)14-17-18(21)7-5-8-19(17)22/h3-9,13,23H,10-12,14H2,1-2H3 |
| InChIKey | CAXNUEGHBCTOIB-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 20.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.33 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|