C23H32Cl3N3 — CID 17215302
N-[[1-[(2-chlorophenyl)methyl]indol-3-yl]methyl]-N',N'-diethylpropane-1,3-diamine;dihydrochloride (PubChem CID 17215302) has the molecular formula C23H32Cl3N3 and a molecular weight of 456.89 g/mol. Its IUPAC name is N-[[1-[(2-chlorophenyl)methyl]indol-3-yl]methyl]-N',N'-diethylpropane-1,3-diamine;dihydrochloride.
| Compound Name | N-[[1-[(2-chlorophenyl)methyl]indol-3-yl]methyl]-N',N'-diethylpropane-1,3-diamine;dihydrochloride |
|---|---|
| PubChem CID | 17215302 |
| Molecular Formula | C23H32Cl3N3 |
| Molecular Weight | 456.89 g/mol |
| Exact Mass | 455.17 |
| IUPAC Name | N-[[1-[(2-chlorophenyl)methyl]indol-3-yl]methyl]-N',N'-diethylpropane-1,3-diamine;dihydrochloride |
| SMILES | CCN(CC)CCCNCc1cn(Cc2ccccc2Cl)c2ccccc12.Cl.Cl |
| InChI | InChI=1S/C23H30ClN3.2ClH/c1-3-26(4-2)15-9-14-25-16-20-18-27(23-13-8-6-11-21(20)23)17-19-10-5-7-12-22(19)24;;/h5-8,10-13,18,25H,3-4,9,14-17H2,1-2H3;2*1H |
| InChIKey | RIXQNOXXTSNDCW-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 20.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.89 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|