C22H27ClFN3 — CID 124824977
N-[[1-[(2-chloro-4-fluorophenyl)methyl]indol-3-yl]methyl]-N',N'-diethylethane-1,2-diamine (PubChem CID 124824977) has the molecular formula C22H27ClFN3 and a molecular weight of 387.93 g/mol. Its IUPAC name is N-[[1-[(2-chloro-4-fluorophenyl)methyl]indol-3-yl]methyl]-N',N'-diethylethane-1,2-diamine.
| Compound Name | N-[[1-[(2-chloro-4-fluorophenyl)methyl]indol-3-yl]methyl]-N',N'-diethylethane-1,2-diamine |
|---|---|
| PubChem CID | 124824977 |
| Molecular Formula | C22H27ClFN3 |
| Molecular Weight | 387.93 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | N-[[1-[(2-chloro-4-fluorophenyl)methyl]indol-3-yl]methyl]-N',N'-diethylethane-1,2-diamine |
| SMILES | CCN(CC)CCNCc1cn(Cc2ccc(F)cc2Cl)c2ccccc12 |
| InChI | InChI=1S/C22H27ClFN3/c1-3-26(4-2)12-11-25-14-18-16-27(22-8-6-5-7-20(18)22)15-17-9-10-19(24)13-21(17)23/h5-10,13,16,25H,3-4,11-12,14-15H2,1-2H3 |
| InChIKey | NIFRFVZFNNMFSE-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 20.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.93 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|