C22H26ClFN2O — CID 124869723
N-[[1-[(2-chloro-4-fluorophenyl)methyl]indol-3-yl]methyl]-3-propan-2-yloxypropan-1-amine (PubChem CID 124869723) has the molecular formula C22H26ClFN2O and a molecular weight of 388.91 g/mol. Its IUPAC name is N-[[1-[(2-chloro-4-fluorophenyl)methyl]indol-3-yl]methyl]-3-propan-2-yloxypropan-1-amine.
| Compound Name | N-[[1-[(2-chloro-4-fluorophenyl)methyl]indol-3-yl]methyl]-3-propan-2-yloxypropan-1-amine |
|---|---|
| PubChem CID | 124869723 |
| Molecular Formula | C22H26ClFN2O |
| Molecular Weight | 388.91 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | N-[[1-[(2-chloro-4-fluorophenyl)methyl]indol-3-yl]methyl]-3-propan-2-yloxypropan-1-amine |
| SMILES | CC(C)OCCCNCc1cn(Cc2ccc(F)cc2Cl)c2ccccc12 |
| InChI | InChI=1S/C22H26ClFN2O/c1-16(2)27-11-5-10-25-13-18-15-26(22-7-4-3-6-20(18)22)14-17-8-9-19(24)12-21(17)23/h3-4,6-9,12,15-16,25H,5,10-11,13-14H2,1-2H3 |
| InChIKey | ZMTXVRRCOCJDKT-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 26.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.91 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|