C21H25Cl2N3O — CID 17159719
1-[2-[[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methylamino]ethylamino]propan-2-ol (PubChem CID 17159719) has the molecular formula C21H25Cl2N3O and a molecular weight of 406.36 g/mol. Its IUPAC name is 1-[2-[[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methylamino]ethylamino]propan-2-ol.
| Compound Name | 1-[2-[[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methylamino]ethylamino]propan-2-ol |
|---|---|
| PubChem CID | 17159719 |
| Molecular Formula | C21H25Cl2N3O |
| Molecular Weight | 406.36 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | 1-[2-[[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methylamino]ethylamino]propan-2-ol |
| SMILES | CC(O)CNCCNCc1cn(Cc2ccc(Cl)cc2Cl)c2ccccc12 |
| InChI | InChI=1S/C21H25Cl2N3O/c1-15(27)11-24-8-9-25-12-17-14-26(21-5-3-2-4-19(17)21)13-16-6-7-18(22)10-20(16)23/h2-7,10,14-15,24-25,27H,8-9,11-13H2,1H3 |
| InChIKey | QFZAYTBGXIMLSG-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 49.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.36 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|