C19H20ClFN2O — CID 124826510
(2R)-1-[[1-[(2-chloro-6-fluorophenyl)methyl]indol-3-yl]methylamino]propan-2-ol (PubChem CID 124826510) has the molecular formula C19H20ClFN2O and a molecular weight of 346.83 g/mol. Its IUPAC name is (2R)-1-[[1-[(2-chloro-6-fluorophenyl)methyl]indol-3-yl]methylamino]propan-2-ol.
| Compound Name | (2R)-1-[[1-[(2-chloro-6-fluorophenyl)methyl]indol-3-yl]methylamino]propan-2-ol |
|---|---|
| PubChem CID | 124826510 |
| Molecular Formula | C19H20ClFN2O |
| Molecular Weight | 346.83 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | (2R)-1-[[1-[(2-chloro-6-fluorophenyl)methyl]indol-3-yl]methylamino]propan-2-ol |
| SMILES | C[C@@H](O)CNCc1cn(Cc2c(F)cccc2Cl)c2ccccc12 |
| InChI | InChI=1S/C19H20ClFN2O/c1-13(24)9-22-10-14-11-23(19-8-3-2-5-15(14)19)12-16-17(20)6-4-7-18(16)21/h2-8,11,13,22,24H,9-10,12H2,1H3/t13-/m1/s1 |
| InChIKey | MWFDSFSFQSGVNP-CYBMUJFWSA-N |
| XLogP | 3.95 |
| TPSA | 37.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.83 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |