C18H18ClFN2 — CID 170868083
3-[1-[(2-chloro-6-fluorophenyl)methyl]indol-3-yl]propan-1-amine (PubChem CID 170868083) has the molecular formula C18H18ClFN2 and a molecular weight of 316.81 g/mol. Its IUPAC name is 3-[1-[(2-chloro-6-fluorophenyl)methyl]indol-3-yl]propan-1-amine.
| Compound Name | 3-[1-[(2-chloro-6-fluorophenyl)methyl]indol-3-yl]propan-1-amine |
|---|---|
| PubChem CID | 170868083 |
| Molecular Formula | C18H18ClFN2 |
| Molecular Weight | 316.81 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | 3-[1-[(2-chloro-6-fluorophenyl)methyl]indol-3-yl]propan-1-amine |
| SMILES | NCCCc1cn(Cc2c(F)cccc2Cl)c2ccccc12 |
| InChI | InChI=1S/C18H18ClFN2/c19-16-7-3-8-17(20)15(16)12-22-11-13(5-4-10-21)14-6-1-2-9-18(14)22/h1-3,6-9,11H,4-5,10,12,21H2 |
| InChIKey | ZKARFFZIQCCPNN-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.81 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |