C21H25ClFN3 — CID 124805104
N-[[1-[(2-chloro-6-fluorophenyl)methyl]indol-3-yl]methyl]-N',N'-dimethylpropane-1,3-diamine (PubChem CID 124805104) has the molecular formula C21H25ClFN3 and a molecular weight of 373.90 g/mol. Its IUPAC name is N-[[1-[(2-chloro-6-fluorophenyl)methyl]indol-3-yl]methyl]-N',N'-dimethylpropane-1,3-diamine.
| Compound Name | N-[[1-[(2-chloro-6-fluorophenyl)methyl]indol-3-yl]methyl]-N',N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 124805104 |
| Molecular Formula | C21H25ClFN3 |
| Molecular Weight | 373.90 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | N-[[1-[(2-chloro-6-fluorophenyl)methyl]indol-3-yl]methyl]-N',N'-dimethylpropane-1,3-diamine |
| SMILES | CN(C)CCCNCc1cn(Cc2c(F)cccc2Cl)c2ccccc12 |
| InChI | InChI=1S/C21H25ClFN3/c1-25(2)12-6-11-24-13-16-14-26(21-10-4-3-7-17(16)21)15-18-19(22)8-5-9-20(18)23/h3-5,7-10,14,24H,6,11-13,15H2,1-2H3 |
| InChIKey | JZLLIRQSFMYDBT-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 20.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.90 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|