C23H30ClN3 — CID 124825576
N-[[1-[(4-chlorophenyl)methyl]indol-3-yl]methyl]-N',N'-diethylpropane-1,3-diamine (PubChem CID 124825576) has the molecular formula C23H30ClN3 and a molecular weight of 383.97 g/mol. Its IUPAC name is N-[[1-[(4-chlorophenyl)methyl]indol-3-yl]methyl]-N',N'-diethylpropane-1,3-diamine.
| Compound Name | N-[[1-[(4-chlorophenyl)methyl]indol-3-yl]methyl]-N',N'-diethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 124825576 |
| Molecular Formula | C23H30ClN3 |
| Molecular Weight | 383.97 g/mol |
| Exact Mass | 383.21 |
| IUPAC Name | N-[[1-[(4-chlorophenyl)methyl]indol-3-yl]methyl]-N',N'-diethylpropane-1,3-diamine |
| SMILES | CCN(CC)CCCNCc1cn(Cc2ccc(Cl)cc2)c2ccccc12 |
| InChI | InChI=1S/C23H30ClN3/c1-3-26(4-2)15-7-14-25-16-20-18-27(23-9-6-5-8-22(20)23)17-19-10-12-21(24)13-11-19/h5-6,8-13,18,25H,3-4,7,14-17H2,1-2H3 |
| InChIKey | SAPSOLOGLQLREU-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 20.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.97 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|