C26H23ClFN3 — CID 124783349
N-[[1-[(2-chloro-4-fluorophenyl)methyl]indol-3-yl]methyl]-2-(1H-indol-3-yl)ethanamine (PubChem CID 124783349) has the molecular formula C26H23ClFN3 and a molecular weight of 431.94 g/mol. Its IUPAC name is N-[[1-[(2-chloro-4-fluorophenyl)methyl]indol-3-yl]methyl]-2-(1H-indol-3-yl)ethanamine.
| Compound Name | N-[[1-[(2-chloro-4-fluorophenyl)methyl]indol-3-yl]methyl]-2-(1H-indol-3-yl)ethanamine |
|---|---|
| PubChem CID | 124783349 |
| Molecular Formula | C26H23ClFN3 |
| Molecular Weight | 431.94 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | N-[[1-[(2-chloro-4-fluorophenyl)methyl]indol-3-yl]methyl]-2-(1H-indol-3-yl)ethanamine |
| SMILES | Fc1ccc(Cn2cc(CNCCc3c[nH]c4ccccc34)c3ccccc32)c(Cl)c1 |
| InChI | InChI=1S/C26H23ClFN3/c27-24-13-21(28)10-9-19(24)16-31-17-20(23-6-2-4-8-26(23)31)14-29-12-11-18-15-30-25-7-3-1-5-22(18)25/h1-10,13,15,17,29-30H,11-12,14,16H2 |
| InChIKey | OAOFQZCZMGUPCO-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 32.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.94 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|