C23H25FN2O4 — CID 53208481
1-[(2-fluorophenyl)methyl]-6-methoxy-3-[(oxolan-2-ylmethylamino)methyl]indole-2-carboxylic acid (PubChem CID 53208481) has the molecular formula C23H25FN2O4 and a molecular weight of 412.46 g/mol. Its IUPAC name is 1-[(2-fluorophenyl)methyl]-6-methoxy-3-[(oxolan-2-ylmethylamino)methyl]indole-2-carboxylic acid.
| Compound Name | 1-[(2-fluorophenyl)methyl]-6-methoxy-3-[(oxolan-2-ylmethylamino)methyl]indole-2-carboxylic acid |
|---|---|
| PubChem CID | 53208481 |
| Molecular Formula | C23H25FN2O4 |
| Molecular Weight | 412.46 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | 1-[(2-fluorophenyl)methyl]-6-methoxy-3-[(oxolan-2-ylmethylamino)methyl]indole-2-carboxylic acid |
| SMILES | COc1ccc2c(CNCC3CCCO3)c(C(=O)O)n(Cc3ccccc3F)c2c1 |
| InChI | InChI=1S/C23H25FN2O4/c1-29-16-8-9-18-19(13-25-12-17-6-4-10-30-17)22(23(27)28)26(21(18)11-16)14-15-5-2-3-7-20(15)24/h2-3,5,7-9,11,17,25H,4,6,10,12-14H2,1H3,(H,27,28) |
| InChIKey | DNDCBDPVFLTCMV-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.46 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|