C25H22BrFN2O3 — CID 53208504
3-[[(3-bromophenyl)methylamino]methyl]-1-[(2-fluorophenyl)methyl]-6-methoxyindole-2-carboxylic acid (PubChem CID 53208504) has the molecular formula C25H22BrFN2O3 and a molecular weight of 497.36 g/mol. Its IUPAC name is 3-[[(3-bromophenyl)methylamino]methyl]-1-[(2-fluorophenyl)methyl]-6-methoxyindole-2-carboxylic acid.
| Compound Name | 3-[[(3-bromophenyl)methylamino]methyl]-1-[(2-fluorophenyl)methyl]-6-methoxyindole-2-carboxylic acid |
|---|---|
| PubChem CID | 53208504 |
| Molecular Formula | C25H22BrFN2O3 |
| Molecular Weight | 497.36 g/mol |
| Exact Mass | 496.08 |
| IUPAC Name | 3-[[(3-bromophenyl)methylamino]methyl]-1-[(2-fluorophenyl)methyl]-6-methoxyindole-2-carboxylic acid |
| SMILES | COc1ccc2c(CNCc3cccc(Br)c3)c(C(=O)O)n(Cc3ccccc3F)c2c1 |
| InChI | InChI=1S/C25H22BrFN2O3/c1-32-19-9-10-20-21(14-28-13-16-5-4-7-18(26)11-16)24(25(30)31)29(23(20)12-19)15-17-6-2-3-8-22(17)27/h2-12,28H,13-15H2,1H3,(H,30,31) |
| InChIKey | XHULOGFCUMFKHQ-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 63.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.36 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|