C26H25FN2O3 — CID 53208619
1-[(4-fluorophenyl)methyl]-6-methoxy-3-[(2-phenylethylamino)methyl]indole-2-carboxylic acid (PubChem CID 53208619) has the molecular formula C26H25FN2O3 and a molecular weight of 432.50 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl]-6-methoxy-3-[(2-phenylethylamino)methyl]indole-2-carboxylic acid.
| Compound Name | 1-[(4-fluorophenyl)methyl]-6-methoxy-3-[(2-phenylethylamino)methyl]indole-2-carboxylic acid |
|---|---|
| PubChem CID | 53208619 |
| Molecular Formula | C26H25FN2O3 |
| Molecular Weight | 432.50 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl]-6-methoxy-3-[(2-phenylethylamino)methyl]indole-2-carboxylic acid |
| SMILES | COc1ccc2c(CNCCc3ccccc3)c(C(=O)O)n(Cc3ccc(F)cc3)c2c1 |
| InChI | InChI=1S/C26H25FN2O3/c1-32-21-11-12-22-23(16-28-14-13-18-5-3-2-4-6-18)25(26(30)31)29(24(22)15-21)17-19-7-9-20(27)10-8-19/h2-12,15,28H,13-14,16-17H2,1H3,(H,30,31) |
| InChIKey | MRZOWFKWKNFQLC-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 63.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.50 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|