C27H26N2O3 — CID 53207363
1-[(4-ethenylphenyl)methyl]-3-[[(3-methoxyphenyl)methylamino]methyl]indole-2-carboxylic acid (PubChem CID 53207363) has the molecular formula C27H26N2O3 and a molecular weight of 426.52 g/mol. Its IUPAC name is 1-[(4-ethenylphenyl)methyl]-3-[[(3-methoxyphenyl)methylamino]methyl]indole-2-carboxylic acid.
| Compound Name | 1-[(4-ethenylphenyl)methyl]-3-[[(3-methoxyphenyl)methylamino]methyl]indole-2-carboxylic acid |
|---|---|
| PubChem CID | 53207363 |
| Molecular Formula | C27H26N2O3 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | 1-[(4-ethenylphenyl)methyl]-3-[[(3-methoxyphenyl)methylamino]methyl]indole-2-carboxylic acid |
| SMILES | C=Cc1ccc(Cn2c(C(=O)O)c(CNCc3cccc(OC)c3)c3ccccc32)cc1 |
| InChI | InChI=1S/C27H26N2O3/c1-3-19-11-13-20(14-12-19)18-29-25-10-5-4-9-23(25)24(26(29)27(30)31)17-28-16-21-7-6-8-22(15-21)32-2/h3-15,28H,1,16-18H2,2H3,(H,30,31) |
| InChIKey | XNKRVVLGHVMHFF-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 63.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|