C18H23N3O2S — CID 49214790
1-methyl-2-oxo-N-[[1-(thiophen-2-ylmethyl)piperidin-3-yl]methyl]pyridine-4-carboxamide (PubChem CID 49214790) has the molecular formula C18H23N3O2S and a molecular weight of 345.47 g/mol. Its IUPAC name is 1-methyl-2-oxo-N-[[1-(thiophen-2-ylmethyl)piperidin-3-yl]methyl]pyridine-4-carboxamide.
| Compound Name | 1-methyl-2-oxo-N-[[1-(thiophen-2-ylmethyl)piperidin-3-yl]methyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 49214790 |
| Molecular Formula | C18H23N3O2S |
| Molecular Weight | 345.47 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | 1-methyl-2-oxo-N-[[1-(thiophen-2-ylmethyl)piperidin-3-yl]methyl]pyridine-4-carboxamide |
| SMILES | Cn1ccc(C(=O)NCC2CCCN(Cc3cccs3)C2)cc1=O |
| InChI | InChI=1S/C18H23N3O2S/c1-20-8-6-15(10-17(20)22)18(23)19-11-14-4-2-7-21(12-14)13-16-5-3-9-24-16/h3,5-6,8-10,14H,2,4,7,11-13H2,1H3,(H,19,23) |
| InChIKey | ONLBEXSFFPOSAS-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.47 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |