C19H28N4OS — CID 49214504
1-tert-butyl-N-[[1-(thiophen-2-ylmethyl)piperidin-3-yl]methyl]pyrazole-4-carboxamide (PubChem CID 49214504) has the molecular formula C19H28N4OS and a molecular weight of 360.53 g/mol. Its IUPAC name is 1-tert-butyl-N-[[1-(thiophen-2-ylmethyl)piperidin-3-yl]methyl]pyrazole-4-carboxamide.
| Compound Name | 1-tert-butyl-N-[[1-(thiophen-2-ylmethyl)piperidin-3-yl]methyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 49214504 |
| Molecular Formula | C19H28N4OS |
| Molecular Weight | 360.53 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | 1-tert-butyl-N-[[1-(thiophen-2-ylmethyl)piperidin-3-yl]methyl]pyrazole-4-carboxamide |
| SMILES | CC(C)(C)n1cc(C(=O)NCC2CCCN(Cc3cccs3)C2)cn1 |
| InChI | InChI=1S/C19H28N4OS/c1-19(2,3)23-13-16(11-21-23)18(24)20-10-15-6-4-8-22(12-15)14-17-7-5-9-25-17/h5,7,9,11,13,15H,4,6,8,10,12,14H2,1-3H3,(H,20,24) |
| InChIKey | LUBHWBXGOGYLOY-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.53 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |