C20H26FN3S — CID 92689876
1-(2-fluorophenyl)-4-[(3S)-1-(thiophen-2-ylmethyl)piperidin-3-yl]piperazine (PubChem CID 92689876) has the molecular formula C20H26FN3S and a molecular weight of 359.51 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-4-[(3S)-1-(thiophen-2-ylmethyl)piperidin-3-yl]piperazine.
| Compound Name | 1-(2-fluorophenyl)-4-[(3S)-1-(thiophen-2-ylmethyl)piperidin-3-yl]piperazine |
|---|---|
| PubChem CID | 92689876 |
| Molecular Formula | C20H26FN3S |
| Molecular Weight | 359.51 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | 1-(2-fluorophenyl)-4-[(3S)-1-(thiophen-2-ylmethyl)piperidin-3-yl]piperazine |
| SMILES | Fc1ccccc1N1CCN([C@H]2CCCN(Cc3cccs3)C2)CC1 |
| InChI | InChI=1S/C20H26FN3S/c21-19-7-1-2-8-20(19)24-12-10-23(11-13-24)17-5-3-9-22(15-17)16-18-6-4-14-25-18/h1-2,4,6-8,14,17H,3,5,9-13,15-16H2/t17-/m0/s1 |
| InChIKey | NMJBZAXBVRSGDP-KRWDZBQOSA-N |
| XLogP | 3.67 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.51 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |