C22H29FN4 — CID 51635907
1-(2-fluorophenyl)-4-[(3S)-1-[(6-methyl-2-pyridinyl)methyl]piperidin-3-yl]piperazine (PubChem CID 51635907) has the molecular formula C22H29FN4 and a molecular weight of 368.50 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-4-[(3S)-1-[(6-methyl-2-pyridinyl)methyl]piperidin-3-yl]piperazine.
| Compound Name | 1-(2-fluorophenyl)-4-[(3S)-1-[(6-methyl-2-pyridinyl)methyl]piperidin-3-yl]piperazine |
|---|---|
| PubChem CID | 51635907 |
| Molecular Formula | C22H29FN4 |
| Molecular Weight | 368.50 g/mol |
| Exact Mass | 368.24 |
| IUPAC Name | 1-(2-fluorophenyl)-4-[(3S)-1-[(6-methyl-2-pyridinyl)methyl]piperidin-3-yl]piperazine |
| SMILES | Cc1cccc(CN2CCC[C@H](N3CCN(c4ccccc4F)CC3)C2)n1 |
| InChI | InChI=1S/C22H29FN4/c1-18-6-4-7-19(24-18)16-25-11-5-8-20(17-25)26-12-14-27(15-13-26)22-10-3-2-9-21(22)23/h2-4,6-7,9-10,20H,5,8,11-17H2,1H3/t20-/m0/s1 |
| InChIKey | KMKKKQKBAZMUGL-FQEVSTJZSA-N |
| XLogP | 3.32 |
| TPSA | 22.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.50 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |