C25H31FN4 — CID 31048886
2-[[(3S)-3-[4-(2-fluorophenyl)piperazin-1-yl]piperidin-1-yl]methyl]-3-methyl-1H-indole (PubChem CID 31048886) has the molecular formula C25H31FN4 and a molecular weight of 406.55 g/mol. Its IUPAC name is 2-[[(3S)-3-[4-(2-fluorophenyl)piperazin-1-yl]piperidin-1-yl]methyl]-3-methyl-1H-indole.
| Compound Name | 2-[[(3S)-3-[4-(2-fluorophenyl)piperazin-1-yl]piperidin-1-yl]methyl]-3-methyl-1H-indole |
|---|---|
| PubChem CID | 31048886 |
| Molecular Formula | C25H31FN4 |
| Molecular Weight | 406.55 g/mol |
| Exact Mass | 406.25 |
| IUPAC Name | 2-[[(3S)-3-[4-(2-fluorophenyl)piperazin-1-yl]piperidin-1-yl]methyl]-3-methyl-1H-indole |
| SMILES | Cc1c(CN2CCC[C@H](N3CCN(c4ccccc4F)CC3)C2)[nH]c2ccccc12 |
| InChI | InChI=1S/C25H31FN4/c1-19-21-8-2-4-10-23(21)27-24(19)18-28-12-6-7-20(17-28)29-13-15-30(16-14-29)25-11-5-3-9-22(25)26/h2-5,8-11,20,27H,6-7,12-18H2,1H3/t20-/m0/s1 |
| InChIKey | PRZSXUPHVPNYCK-FQEVSTJZSA-N |
| XLogP | 4.40 |
| TPSA | 25.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.55 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|