C18H27N3O2S — CID 95227221
N-[2-[(3R)-1-[(3-methyl-1H-indol-2-yl)methyl]piperidin-3-yl]ethyl]methanesulfonamide (PubChem CID 95227221) has the molecular formula C18H27N3O2S and a molecular weight of 349.50 g/mol. Its IUPAC name is N-[2-[(3R)-1-[(3-methyl-1H-indol-2-yl)methyl]piperidin-3-yl]ethyl]methanesulfonamide.
| Compound Name | N-[2-[(3R)-1-[(3-methyl-1H-indol-2-yl)methyl]piperidin-3-yl]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 95227221 |
| Molecular Formula | C18H27N3O2S |
| Molecular Weight | 349.50 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | N-[2-[(3R)-1-[(3-methyl-1H-indol-2-yl)methyl]piperidin-3-yl]ethyl]methanesulfonamide |
| SMILES | Cc1c(CN2CCC[C@H](CCNS(C)(=O)=O)C2)[nH]c2ccccc12 |
| InChI | InChI=1S/C18H27N3O2S/c1-14-16-7-3-4-8-17(16)20-18(14)13-21-11-5-6-15(12-21)9-10-19-24(2,22)23/h3-4,7-8,15,19-20H,5-6,9-13H2,1-2H3/t15-/m1/s1 |
| InChIKey | QPTDZAIAHACBQH-OAHLLOKOSA-N |
| XLogP | 2.63 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.50 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|