C18H25N3O2S — CID 95218558
N-[[(3R)-1-[(8-methylquinolin-5-yl)methyl]piperidin-3-yl]methyl]methanesulfonamide (PubChem CID 95218558) has the molecular formula C18H25N3O2S and a molecular weight of 347.48 g/mol. Its IUPAC name is N-[[(3R)-1-[(8-methylquinolin-5-yl)methyl]piperidin-3-yl]methyl]methanesulfonamide.
| Compound Name | N-[[(3R)-1-[(8-methylquinolin-5-yl)methyl]piperidin-3-yl]methyl]methanesulfonamide |
|---|---|
| PubChem CID | 95218558 |
| Molecular Formula | C18H25N3O2S |
| Molecular Weight | 347.48 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | N-[[(3R)-1-[(8-methylquinolin-5-yl)methyl]piperidin-3-yl]methyl]methanesulfonamide |
| SMILES | Cc1ccc(CN2CCC[C@@H](CNS(C)(=O)=O)C2)c2cccnc12 |
| InChI | InChI=1S/C18H25N3O2S/c1-14-7-8-16(17-6-3-9-19-18(14)17)13-21-10-4-5-15(12-21)11-20-24(2,22)23/h3,6-9,15,20H,4-5,10-13H2,1-2H3/t15-/m0/s1 |
| InChIKey | HKVWVSNXDJIHSC-HNNXBMFYSA-N |
| XLogP | 2.30 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.48 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |