C20H29N3O2S — CID 45210111
N-[[1-(2,2-dimethylpropyl)piperidin-3-yl]methyl]quinoline-8-sulfonamide (PubChem CID 45210111) has the molecular formula C20H29N3O2S and a molecular weight of 375.54 g/mol. Its IUPAC name is N-[[1-(2,2-dimethylpropyl)piperidin-3-yl]methyl]quinoline-8-sulfonamide.
| Compound Name | N-[[1-(2,2-dimethylpropyl)piperidin-3-yl]methyl]quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 45210111 |
| Molecular Formula | C20H29N3O2S |
| Molecular Weight | 375.54 g/mol |
| Exact Mass | 375.20 |
| IUPAC Name | N-[[1-(2,2-dimethylpropyl)piperidin-3-yl]methyl]quinoline-8-sulfonamide |
| SMILES | CC(C)(C)CN1CCCC(CNS(=O)(=O)c2cccc3cccnc23)C1 |
| InChI | InChI=1S/C20H29N3O2S/c1-20(2,3)15-23-12-6-7-16(14-23)13-22-26(24,25)18-10-4-8-17-9-5-11-21-19(17)18/h4-5,8-11,16,22H,6-7,12-15H2,1-3H3 |
| InChIKey | KAOMHXJAISWPGV-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.54 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |