C19H32N2O4S — CID 97237584
N-[[(3S)-1-[(3-ethoxy-2-propoxyphenyl)methyl]piperidin-3-yl]methyl]methanesulfonamide (PubChem CID 97237584) has the molecular formula C19H32N2O4S and a molecular weight of 384.54 g/mol. Its IUPAC name is N-[[(3S)-1-[(3-ethoxy-2-propoxyphenyl)methyl]piperidin-3-yl]methyl]methanesulfonamide.
| Compound Name | N-[[(3S)-1-[(3-ethoxy-2-propoxyphenyl)methyl]piperidin-3-yl]methyl]methanesulfonamide |
|---|---|
| PubChem CID | 97237584 |
| Molecular Formula | C19H32N2O4S |
| Molecular Weight | 384.54 g/mol |
| Exact Mass | 384.21 |
| IUPAC Name | N-[[(3S)-1-[(3-ethoxy-2-propoxyphenyl)methyl]piperidin-3-yl]methyl]methanesulfonamide |
| SMILES | CCCOc1c(CN2CCC[C@H](CNS(C)(=O)=O)C2)cccc1OCC |
| InChI | InChI=1S/C19H32N2O4S/c1-4-12-25-19-17(9-6-10-18(19)24-5-2)15-21-11-7-8-16(14-21)13-20-26(3,22)23/h6,9-10,16,20H,4-5,7-8,11-15H2,1-3H3/t16-/m1/s1 |
| InChIKey | BQJGPRDTDXKQOT-MRXNPFEDSA-N |
| XLogP | 2.64 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.54 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |