C26H34N4O — CID 29219340
2-[[(3R)-3-[4-(2-methoxyphenyl)piperazin-1-yl]piperidin-1-yl]methyl]-3-methyl-1H-indole (PubChem CID 29219340) has the molecular formula C26H34N4O and a molecular weight of 418.59 g/mol. Its IUPAC name is 2-[[(3R)-3-[4-(2-methoxyphenyl)piperazin-1-yl]piperidin-1-yl]methyl]-3-methyl-1H-indole.
| Compound Name | 2-[[(3R)-3-[4-(2-methoxyphenyl)piperazin-1-yl]piperidin-1-yl]methyl]-3-methyl-1H-indole |
|---|---|
| PubChem CID | 29219340 |
| Molecular Formula | C26H34N4O |
| Molecular Weight | 418.59 g/mol |
| Exact Mass | 418.27 |
| IUPAC Name | 2-[[(3R)-3-[4-(2-methoxyphenyl)piperazin-1-yl]piperidin-1-yl]methyl]-3-methyl-1H-indole |
| SMILES | COc1ccccc1N1CCN([C@@H]2CCCN(Cc3[nH]c4ccccc4c3C)C2)CC1 |
| InChI | InChI=1S/C26H34N4O/c1-20-22-9-3-4-10-23(22)27-24(20)19-28-13-7-8-21(18-28)29-14-16-30(17-15-29)25-11-5-6-12-26(25)31-2/h3-6,9-12,21,27H,7-8,13-19H2,1-2H3/t21-/m1/s1 |
| InChIKey | PSWSZLNEMPJBJV-OAQYLSRUSA-N |
| XLogP | 4.27 |
| TPSA | 34.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.59 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|