C19H19FN4O3S — CID 26491115
1-[[4-(2-fluorophenyl)piperazin-1-yl]methyl]-3-(thiophen-2-ylmethyl)imidazolidine-2,4,5-trione (PubChem CID 26491115) has the molecular formula C19H19FN4O3S and a molecular weight of 402.45 g/mol. Its IUPAC name is 1-[[4-(2-fluorophenyl)piperazin-1-yl]methyl]-3-(thiophen-2-ylmethyl)imidazolidine-2,4,5-trione.
| Compound Name | 1-[[4-(2-fluorophenyl)piperazin-1-yl]methyl]-3-(thiophen-2-ylmethyl)imidazolidine-2,4,5-trione |
|---|---|
| PubChem CID | 26491115 |
| Molecular Formula | C19H19FN4O3S |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | 1-[[4-(2-fluorophenyl)piperazin-1-yl]methyl]-3-(thiophen-2-ylmethyl)imidazolidine-2,4,5-trione |
| SMILES | O=C1C(=O)N(CN2CCN(c3ccccc3F)CC2)C(=O)N1Cc1cccs1 |
| InChI | InChI=1S/C19H19FN4O3S/c20-15-5-1-2-6-16(15)22-9-7-21(8-10-22)13-24-18(26)17(25)23(19(24)27)12-14-4-3-11-28-14/h1-6,11H,7-10,12-13H2 |
| InChIKey | ROUKGBAMOGIIDK-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 64.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|