C11H16ClNS — CID 102959815
3-chloro-4-methyl-1-(thiophen-2-ylmethyl)piperidine (PubChem CID 102959815) has the molecular formula C11H16ClNS and a molecular weight of 229.78 g/mol. Its IUPAC name is 3-chloro-4-methyl-1-(thiophen-2-ylmethyl)piperidine.
| Compound Name | 3-chloro-4-methyl-1-(thiophen-2-ylmethyl)piperidine |
|---|---|
| PubChem CID | 102959815 |
| Molecular Formula | C11H16ClNS |
| Molecular Weight | 229.78 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | 3-chloro-4-methyl-1-(thiophen-2-ylmethyl)piperidine |
| SMILES | CC1CCN(Cc2cccs2)CC1Cl |
| InChI | InChI=1S/C11H16ClNS/c1-9-4-5-13(8-11(9)12)7-10-3-2-6-14-10/h2-3,6,9,11H,4-5,7-8H2,1H3 |
| InChIKey | YBAQAUJAFGBCSD-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.78 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|