C15H22ClN — CID 102959994
3-chloro-1-[(2,6-dimethylphenyl)methyl]-4-methylpiperidine (PubChem CID 102959994) has the molecular formula C15H22ClN and a molecular weight of 251.80 g/mol. Its IUPAC name is 3-chloro-1-[(2,6-dimethylphenyl)methyl]-4-methylpiperidine.
| Compound Name | 3-chloro-1-[(2,6-dimethylphenyl)methyl]-4-methylpiperidine |
|---|---|
| PubChem CID | 102959994 |
| Molecular Formula | C15H22ClN |
| Molecular Weight | 251.80 g/mol |
| Exact Mass | 251.14 |
| IUPAC Name | 3-chloro-1-[(2,6-dimethylphenyl)methyl]-4-methylpiperidine |
| SMILES | Cc1cccc(C)c1CN1CCC(C)C(Cl)C1 |
| InChI | InChI=1S/C15H22ClN/c1-11-5-4-6-12(2)14(11)9-17-8-7-13(3)15(16)10-17/h4-6,13,15H,7-10H2,1-3H3 |
| InChIKey | LOAWQBYQLSYTHZ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.80 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|