C13H16BrCl2N — CID 102960502
3-bromo-1-[(2,6-dichlorophenyl)methyl]-4-methylpiperidine (PubChem CID 102960502) has the molecular formula C13H16BrCl2N and a molecular weight of 337.09 g/mol. Its IUPAC name is 3-bromo-1-[(2,6-dichlorophenyl)methyl]-4-methylpiperidine.
| Compound Name | 3-bromo-1-[(2,6-dichlorophenyl)methyl]-4-methylpiperidine |
|---|---|
| PubChem CID | 102960502 |
| Molecular Formula | C13H16BrCl2N |
| Molecular Weight | 337.09 g/mol |
| Exact Mass | 334.98 |
| IUPAC Name | 3-bromo-1-[(2,6-dichlorophenyl)methyl]-4-methylpiperidine |
| SMILES | CC1CCN(Cc2c(Cl)cccc2Cl)CC1Br |
| InChI | InChI=1S/C13H16BrCl2N/c1-9-5-6-17(8-11(9)14)7-10-12(15)3-2-4-13(10)16/h2-4,9,11H,5-8H2,1H3 |
| InChIKey | JPTPOFUTKCGTSF-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.09 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|