C12H16Cl2N2 — CID 62069136
[1-[(2,6-dichlorophenyl)methyl]pyrrolidin-3-yl]methanamine (PubChem CID 62069136) has the molecular formula C12H16Cl2N2 and a molecular weight of 259.18 g/mol. Its IUPAC name is [1-[(2,6-dichlorophenyl)methyl]pyrrolidin-3-yl]methanamine.
| Compound Name | [1-[(2,6-dichlorophenyl)methyl]pyrrolidin-3-yl]methanamine |
|---|---|
| PubChem CID | 62069136 |
| Molecular Formula | C12H16Cl2N2 |
| Molecular Weight | 259.18 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | [1-[(2,6-dichlorophenyl)methyl]pyrrolidin-3-yl]methanamine |
| SMILES | NCC1CCN(Cc2c(Cl)cccc2Cl)C1 |
| InChI | InChI=1S/C12H16Cl2N2/c13-11-2-1-3-12(14)10(11)8-16-5-4-9(6-15)7-16/h1-3,9H,4-8,15H2 |
| InChIKey | BNTIGJUUMQFLME-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.18 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |