About [1-[(3,5-dichloro-4-pyridinyl)methyl]pyrrolidin-3-yl]methanamine;dihydrochloride
[1-[(3,5-dichloro-4-pyridinyl)methyl]pyrrolidin-3-yl]methanamine;dihydrochloride (PubChem CID 154906521) has the molecular formula C11H17Cl4N3
and a molecular weight of 333.09 g/mol. Its IUPAC name is [1-[(3,5-dichloro-4-pyridinyl)methyl]pyrrolidin-3-yl]methanamine;dihydrochloride.
Molecular Properties
| Compound Name | [1-[(3,5-dichloro-4-pyridinyl)methyl]pyrrolidin-3-yl]methanamine;dihydrochloride |
| PubChem CID | 154906521 |
| Molecular Formula | C11H17Cl4N3 |
| Molecular Weight | 333.09 g/mol |
| Exact Mass | 331.02 |
| IUPAC Name | [1-[(3,5-dichloro-4-pyridinyl)methyl]pyrrolidin-3-yl]methanamine;dihydrochloride |
| SMILES | Cl.Cl.NCC1CCN(Cc2c(Cl)cncc2Cl)C1 |
| InChI | InChI=1S/C11H15Cl2N3.2ClH/c12-10-4-15-5-11(13)9(10)7-16-2-1-8(3-14)6-16;;/h4-5,8H,1-3,6-7,14H2;2*1H |
| InChIKey | AQRZCRUBCSMYLF-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.09 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [1-[(3,5-dichloro-4-pyridinyl)methyl]pyrrolidin-3-yl]methanamine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[(3,5-dichloro-4-pyridinyl)methyl]pyrrolidin-3-yl]methanamine;dihydrochloride?
The IUPAC name of [1-[(3,5-dichloro-4-pyridinyl)methyl]pyrrolidin-3-yl]methanamine;dihydrochloride (CID 154906521) is [1-[(3,5-dichloro-4-pyridinyl)methyl]pyrrolidin-3-yl]methanamine;dihydrochloride.
What is the SMILES notation for [1-[(3,5-dichloro-4-pyridinyl)methyl]pyrrolidin-3-yl]methanamine;dihydrochloride?
The canonical SMILES for [1-[(3,5-dichloro-4-pyridinyl)methyl]pyrrolidin-3-yl]methanamine;dihydrochloride is Cl.Cl.NCC1CCN(Cc2c(Cl)cncc2Cl)C1.
What is the InChIKey of [1-[(3,5-dichloro-4-pyridinyl)methyl]pyrrolidin-3-yl]methanamine;dihydrochloride?
The InChIKey is AQRZCRUBCSMYLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15Cl2N3.2ClH/c12-10-4-15-5-11(13)9(10)7-16-2-1-8(3-14)6-16;;/h4-5,8H,1-3,6-7,14H2;2*1H.
What are the key properties of [1-[(3,5-dichloro-4-pyridinyl)methyl]pyrrolidin-3-yl]methanamine;dihydrochloride?
[1-[(3,5-dichloro-4-pyridinyl)methyl]pyrrolidin-3-yl]methanamine;dihydrochloride has a molecular weight of 333.09 g/mol, XLogP of 3.01, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[(3,5-dichloro-4-pyridinyl)methyl]pyrrolidin-3-yl]methanamine;dihydrochloride is sourced from PubChem (CID 154906521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).