C10H15ClN4 — CID 71644949
[1-[(3-chloropyrazin-2-yl)methyl]pyrrolidin-3-yl]methanamine (PubChem CID 71644949) has the molecular formula C10H15ClN4 and a molecular weight of 226.71 g/mol. Its IUPAC name is [1-[(3-chloropyrazin-2-yl)methyl]pyrrolidin-3-yl]methanamine.
| Compound Name | [1-[(3-chloropyrazin-2-yl)methyl]pyrrolidin-3-yl]methanamine |
|---|---|
| PubChem CID | 71644949 |
| Molecular Formula | C10H15ClN4 |
| Molecular Weight | 226.71 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | [1-[(3-chloropyrazin-2-yl)methyl]pyrrolidin-3-yl]methanamine |
| SMILES | NCC1CCN(Cc2nccnc2Cl)C1 |
| InChI | InChI=1S/C10H15ClN4/c11-10-9(13-2-3-14-10)7-15-4-1-8(5-12)6-15/h2-3,8H,1,4-7,12H2 |
| InChIKey | JGDKZACGOMABNL-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.71 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |