C13H19ClN2O — CID 104816715
[1-[(2-chloro-6-methoxyphenyl)methyl]pyrrolidin-3-yl]methanamine (PubChem CID 104816715) has the molecular formula C13H19ClN2O and a molecular weight of 254.76 g/mol. Its IUPAC name is [1-[(2-chloro-6-methoxyphenyl)methyl]pyrrolidin-3-yl]methanamine.
| Compound Name | [1-[(2-chloro-6-methoxyphenyl)methyl]pyrrolidin-3-yl]methanamine |
|---|---|
| PubChem CID | 104816715 |
| Molecular Formula | C13H19ClN2O |
| Molecular Weight | 254.76 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | [1-[(2-chloro-6-methoxyphenyl)methyl]pyrrolidin-3-yl]methanamine |
| SMILES | COc1cccc(Cl)c1CN1CCC(CN)C1 |
| InChI | InChI=1S/C13H19ClN2O/c1-17-13-4-2-3-12(14)11(13)9-16-6-5-10(7-15)8-16/h2-4,10H,5-9,15H2,1H3 |
| InChIKey | ACDJUYBWSKLAFY-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.76 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |