C18H21ClN2O — CID 120770160
(3S,4R)-1-[(2-chloro-6-methoxyphenyl)methyl]-4-phenylpyrrolidin-3-amine (PubChem CID 120770160) has the molecular formula C18H21ClN2O and a molecular weight of 316.83 g/mol. Its IUPAC name is (3S,4R)-1-[(2-chloro-6-methoxyphenyl)methyl]-4-phenylpyrrolidin-3-amine.
| Compound Name | (3S,4R)-1-[(2-chloro-6-methoxyphenyl)methyl]-4-phenylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 120770160 |
| Molecular Formula | C18H21ClN2O |
| Molecular Weight | 316.83 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | (3S,4R)-1-[(2-chloro-6-methoxyphenyl)methyl]-4-phenylpyrrolidin-3-amine |
| SMILES | COc1cccc(Cl)c1CN1C[C@@H](N)[C@H](c2ccccc2)C1 |
| InChI | InChI=1S/C18H21ClN2O/c1-22-18-9-5-8-16(19)15(18)11-21-10-14(17(20)12-21)13-6-3-2-4-7-13/h2-9,14,17H,10-12,20H2,1H3/t14-,17+/m0/s1 |
| InChIKey | HIKCIGSDPDUMEW-WMLDXEAASA-N |
| XLogP | 3.28 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.83 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |