C13H20N2O — CID 89188602
(3S,4R)-1-(2-methoxyethyl)-4-phenylpyrrolidin-3-amine (PubChem CID 89188602) has the molecular formula C13H20N2O and a molecular weight of 220.32 g/mol. Its IUPAC name is (3S,4R)-1-(2-methoxyethyl)-4-phenylpyrrolidin-3-amine.
| Compound Name | (3S,4R)-1-(2-methoxyethyl)-4-phenylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 89188602 |
| Molecular Formula | C13H20N2O |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | (3S,4R)-1-(2-methoxyethyl)-4-phenylpyrrolidin-3-amine |
| SMILES | COCCN1C[C@@H](N)[C@H](c2ccccc2)C1 |
| InChI | InChI=1S/C13H20N2O/c1-16-8-7-15-9-12(13(14)10-15)11-5-3-2-4-6-11/h2-6,12-13H,7-10,14H2,1H3/t12-,13+/m0/s1 |
| InChIKey | UIUYSXXWKSJSNW-QWHCGFSZSA-N |
| XLogP | 1.06 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |