C19H23BrN2O2 — CID 120760275
(3S,4R)-1-[(2-bromo-3,4-dimethoxyphenyl)methyl]-4-phenylpyrrolidin-3-amine (PubChem CID 120760275) has the molecular formula C19H23BrN2O2 and a molecular weight of 391.31 g/mol. Its IUPAC name is (3S,4R)-1-[(2-bromo-3,4-dimethoxyphenyl)methyl]-4-phenylpyrrolidin-3-amine.
| Compound Name | (3S,4R)-1-[(2-bromo-3,4-dimethoxyphenyl)methyl]-4-phenylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 120760275 |
| Molecular Formula | C19H23BrN2O2 |
| Molecular Weight | 391.31 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | (3S,4R)-1-[(2-bromo-3,4-dimethoxyphenyl)methyl]-4-phenylpyrrolidin-3-amine |
| SMILES | COc1ccc(CN2C[C@@H](N)[C@H](c3ccccc3)C2)c(Br)c1OC |
| InChI | InChI=1S/C19H23BrN2O2/c1-23-17-9-8-14(18(20)19(17)24-2)10-22-11-15(16(21)12-22)13-6-4-3-5-7-13/h3-9,15-16H,10-12,21H2,1-2H3/t15-,16+/m0/s1 |
| InChIKey | IOIIGXZURZPVPK-JKSUJKDBSA-N |
| XLogP | 3.39 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.31 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |