C13H16ClF2N — CID 102960013
3-chloro-1-[(3,5-difluorophenyl)methyl]-4-methylpiperidine (PubChem CID 102960013) has the molecular formula C13H16ClF2N and a molecular weight of 259.73 g/mol. Its IUPAC name is 3-chloro-1-[(3,5-difluorophenyl)methyl]-4-methylpiperidine.
| Compound Name | 3-chloro-1-[(3,5-difluorophenyl)methyl]-4-methylpiperidine |
|---|---|
| PubChem CID | 102960013 |
| Molecular Formula | C13H16ClF2N |
| Molecular Weight | 259.73 g/mol |
| Exact Mass | 259.09 |
| IUPAC Name | 3-chloro-1-[(3,5-difluorophenyl)methyl]-4-methylpiperidine |
| SMILES | CC1CCN(Cc2cc(F)cc(F)c2)CC1Cl |
| InChI | InChI=1S/C13H16ClF2N/c1-9-2-3-17(8-13(9)14)7-10-4-11(15)6-12(16)5-10/h4-6,9,13H,2-3,7-8H2,1H3 |
| InChIKey | GWRTXNYOBQPCTM-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.73 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|