C15H20F4N2 — CID 114960042
[1-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]-4-methylpiperidin-3-yl]methanamine (PubChem CID 114960042) has the molecular formula C15H20F4N2 and a molecular weight of 304.33 g/mol. Its IUPAC name is [1-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]-4-methylpiperidin-3-yl]methanamine.
| Compound Name | [1-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]-4-methylpiperidin-3-yl]methanamine |
|---|---|
| PubChem CID | 114960042 |
| Molecular Formula | C15H20F4N2 |
| Molecular Weight | 304.33 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | [1-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]-4-methylpiperidin-3-yl]methanamine |
| SMILES | CC1CCN(Cc2cc(F)cc(C(F)(F)F)c2)CC1CN |
| InChI | InChI=1S/C15H20F4N2/c1-10-2-3-21(9-12(10)7-20)8-11-4-13(15(17,18)19)6-14(16)5-11/h4-6,10,12H,2-3,7-9,20H2,1H3 |
| InChIKey | AUJZHAFBXCCIBY-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.33 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |