C14H18F4N2 — CID 120780785
[1-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]-3-methylpyrrolidin-3-yl]methanamine (PubChem CID 120780785) has the molecular formula C14H18F4N2 and a molecular weight of 290.30 g/mol. Its IUPAC name is [1-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]-3-methylpyrrolidin-3-yl]methanamine.
| Compound Name | [1-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]-3-methylpyrrolidin-3-yl]methanamine |
|---|---|
| PubChem CID | 120780785 |
| Molecular Formula | C14H18F4N2 |
| Molecular Weight | 290.30 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | [1-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]-3-methylpyrrolidin-3-yl]methanamine |
| SMILES | CC1(CN)CCN(Cc2cc(F)cc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C14H18F4N2/c1-13(8-19)2-3-20(9-13)7-10-4-11(14(16,17)18)6-12(15)5-10/h4-6H,2-3,7-9,19H2,1H3 |
| InChIKey | USYWMBLDAHRZMN-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.30 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |