C17H29ClN2 — CID 120771872
[1-[(4-tert-butylphenyl)methyl]-3-methylpyrrolidin-3-yl]methanamine;hydrochloride (PubChem CID 120771872) has the molecular formula C17H29ClN2 and a molecular weight of 296.89 g/mol. Its IUPAC name is [1-[(4-tert-butylphenyl)methyl]-3-methylpyrrolidin-3-yl]methanamine;hydrochloride.
| Compound Name | [1-[(4-tert-butylphenyl)methyl]-3-methylpyrrolidin-3-yl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 120771872 |
| Molecular Formula | C17H29ClN2 |
| Molecular Weight | 296.89 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | [1-[(4-tert-butylphenyl)methyl]-3-methylpyrrolidin-3-yl]methanamine;hydrochloride |
| SMILES | CC1(CN)CCN(Cc2ccc(C(C)(C)C)cc2)C1.Cl |
| InChI | InChI=1S/C17H28N2.ClH/c1-16(2,3)15-7-5-14(6-8-15)11-19-10-9-17(4,12-18)13-19;/h5-8H,9-13,18H2,1-4H3;1H |
| InChIKey | IVRNQCMUYOXPDT-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.89 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |